3-aminopentan-3-yl hydrogen sulfate

C5H13NO4S — CID 88690327

IUPAC3-aminopentan-3-yl hydrogen sulfate
SMILESCCC(N)(CC)OS(=O)(=O)O
InChIInChI=1S/C5H13NO4S/c1-3-5(6,4-2)10-11(7,8)9/h3-4,6H2,1-2H3,(H,7,8,9)
InChIKeyRHQVFYNDKKYLQY-UHFFFAOYSA-N
MW183.23 g/mol
LogP0.28
Rot. Bonds4

About 3-aminopentan-3-yl hydrogen sulfate

3-aminopentan-3-yl hydrogen sulfate (PubChem CID 88690327) has the molecular formula C5H13NO4S and a molecular weight of 183.23 g/mol. Its IUPAC name is 3-aminopentan-3-yl hydrogen sulfate.

Molecular Properties

Compound Name3-aminopentan-3-yl hydrogen sulfate
PubChem CID88690327
Molecular FormulaC5H13NO4S
Molecular Weight183.23 g/mol
Exact Mass183.06
IUPAC Name3-aminopentan-3-yl hydrogen sulfate
SMILESCCC(N)(CC)OS(=O)(=O)O
InChIInChI=1S/C5H13NO4S/c1-3-5(6,4-2)10-11(7,8)9/h3-4,6H2,1-2H3,(H,7,8,9)
InChIKeyRHQVFYNDKKYLQY-UHFFFAOYSA-N
XLogP0.28
TPSA89.62 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.23
LogP ≤ 50.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-aminopentan-3-yl hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-aminopentan-3-yl hydrogen sulfate?
The IUPAC name of 3-aminopentan-3-yl hydrogen sulfate (CID 88690327) is 3-aminopentan-3-yl hydrogen sulfate.
What is the SMILES notation for 3-aminopentan-3-yl hydrogen sulfate?
The canonical SMILES for 3-aminopentan-3-yl hydrogen sulfate is CCC(N)(CC)OS(=O)(=O)O.
What is the InChIKey of 3-aminopentan-3-yl hydrogen sulfate?
The InChIKey is RHQVFYNDKKYLQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO4S/c1-3-5(6,4-2)10-11(7,8)9/h3-4,6H2,1-2H3,(H,7,8,9).
What are the key properties of 3-aminopentan-3-yl hydrogen sulfate?
3-aminopentan-3-yl hydrogen sulfate has a molecular weight of 183.23 g/mol, XLogP of 0.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopentan-3-yl hydrogen sulfate is sourced from PubChem (CID 88690327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).