C6H16N3OPS2 — CID 88694464
N-diaminophosphinothioyl-2-methyl-2-(sulfanylmethyl)butanamide (PubChem CID 88694464) has the molecular formula C6H16N3OPS2 and a molecular weight of 241.32 g/mol. Its IUPAC name is N-diaminophosphinothioyl-2-methyl-2-(sulfanylmethyl)butanamide.
| Compound Name | N-diaminophosphinothioyl-2-methyl-2-(sulfanylmethyl)butanamide |
|---|---|
| PubChem CID | 88694464 |
| Molecular Formula | C6H16N3OPS2 |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | N-diaminophosphinothioyl-2-methyl-2-(sulfanylmethyl)butanamide |
| SMILES | CCC(C)(CS)C(=O)NP(N)(N)=S |
| InChI | InChI=1S/C6H16N3OPS2/c1-3-6(2,4-12)5(10)9-11(7,8)13/h12H,3-4H2,1-2H3,(H5,7,8,9,10,13) |
| InChIKey | JBVARUHUFULGEP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|