About disodium;phosphono phosphonatoformate
disodium;phosphono phosphonatoformate (PubChem CID 88694524) has the molecular formula CH2Na2O8P2
and a molecular weight of 249.95 g/mol. Its IUPAC name is disodium;phosphono phosphonatoformate.
Molecular Properties
| Compound Name | disodium;phosphono phosphonatoformate |
| PubChem CID | 88694524 |
| Molecular Formula | CH2Na2O8P2 |
| Molecular Weight | 249.95 g/mol |
| Exact Mass | 249.90 |
| IUPAC Name | disodium;phosphono phosphonatoformate |
| SMILES | O=C(OP(=O)(O)O)P(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/CH4O8P2.2Na/c2-1(10(3,4)5)9-11(6,7)8;;/h(H2,3,4,5)(H2,6,7,8);;/q;2*+1/p-2 |
| InChIKey | FMWCPDHTZBZOCC-UHFFFAOYSA-L |
| XLogP | -7.86 |
| TPSA | 147.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.95 |
| LogP ≤ 5 | -7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;phosphono phosphonatoformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;phosphono phosphonatoformate?
The IUPAC name of disodium;phosphono phosphonatoformate (CID 88694524) is disodium;phosphono phosphonatoformate.
What is the SMILES notation for disodium;phosphono phosphonatoformate?
The canonical SMILES for disodium;phosphono phosphonatoformate is O=C(OP(=O)(O)O)P(=O)([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;phosphono phosphonatoformate?
The InChIKey is FMWCPDHTZBZOCC-UHFFFAOYSA-L. The full InChI is InChI=1S/CH4O8P2.2Na/c2-1(10(3,4)5)9-11(6,7)8;;/h(H2,3,4,5)(H2,6,7,8);;/q;2*+1/p-2.
What are the key properties of disodium;phosphono phosphonatoformate?
disodium;phosphono phosphonatoformate has a molecular weight of 249.95 g/mol, XLogP of -7.86, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;phosphono phosphonatoformate is sourced from PubChem (CID 88694524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).