About sodium;hydride;phosphono carbamate
sodium;hydride;phosphono carbamate (PubChem CID 173413043) has the molecular formula CH5NNaO5P
and a molecular weight of 165.02 g/mol. Its IUPAC name is sodium;hydride;phosphono carbamate.
Molecular Properties
| Compound Name | sodium;hydride;phosphono carbamate |
| PubChem CID | 173413043 |
| Molecular Formula | CH5NNaO5P |
| Molecular Weight | 165.02 g/mol |
| Exact Mass | 164.98 |
| IUPAC Name | sodium;hydride;phosphono carbamate |
| SMILES | NC(=O)OP(=O)(O)O.[H-].[Na+] |
| InChI | InChI=1S/CH4NO5P.Na.H/c2-1(3)7-8(4,5)6;;/h(H2,2,3)(H2,4,5,6);;/q;+1;-1 |
| InChIKey | RZJGUYJHVAFXSH-UHFFFAOYSA-N |
| XLogP | -3.71 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.02 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;phosphono carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;phosphono carbamate?
The IUPAC name of sodium;hydride;phosphono carbamate (CID 173413043) is sodium;hydride;phosphono carbamate.
What is the SMILES notation for sodium;hydride;phosphono carbamate?
The canonical SMILES for sodium;hydride;phosphono carbamate is NC(=O)OP(=O)(O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;phosphono carbamate?
The InChIKey is RZJGUYJHVAFXSH-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4NO5P.Na.H/c2-1(3)7-8(4,5)6;;/h(H2,2,3)(H2,4,5,6);;/q;+1;-1.
What are the key properties of sodium;hydride;phosphono carbamate?
sodium;hydride;phosphono carbamate has a molecular weight of 165.02 g/mol, XLogP of -3.71, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;phosphono carbamate is sourced from PubChem (CID 173413043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).