CH5NO8P2 — CID 174634052
[hydroxy(phosphonooxy)phosphoryl] carbamate (PubChem CID 174634052) has the molecular formula CH5NO8P2 and a molecular weight of 221.00 g/mol. Its IUPAC name is [hydroxy(phosphonooxy)phosphoryl] carbamate.
| Compound Name | [hydroxy(phosphonooxy)phosphoryl] carbamate |
|---|---|
| PubChem CID | 174634052 |
| Molecular Formula | CH5NO8P2 |
| Molecular Weight | 221.00 g/mol |
| Exact Mass | 220.95 |
| IUPAC Name | [hydroxy(phosphonooxy)phosphoryl] carbamate |
| SMILES | NC(=O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/CH5NO8P2/c2-1(3)9-12(7,8)10-11(4,5)6/h(H2,2,3)(H,7,8)(H2,4,5,6) |
| InChIKey | YERONCCXYORJBK-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.00 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|