C14H17NO4S — CID 88697542
[2-(2-methyl-3-sulfanylpropanoyl)-3,4-dihydro-1H-isoquinolin-3-yl] hydrogen carbonate (PubChem CID 88697542) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is [2-(2-methyl-3-sulfanylpropanoyl)-3,4-dihydro-1H-isoquinolin-3-yl] hydrogen carbonate.
| Compound Name | [2-(2-methyl-3-sulfanylpropanoyl)-3,4-dihydro-1H-isoquinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 88697542 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | [2-(2-methyl-3-sulfanylpropanoyl)-3,4-dihydro-1H-isoquinolin-3-yl] hydrogen carbonate |
| SMILES | CC(CS)C(=O)N1Cc2ccccc2CC1OC(=O)O |
| InChI | InChI=1S/C14H17NO4S/c1-9(8-20)13(16)15-7-11-5-3-2-4-10(11)6-12(15)19-14(17)18/h2-5,9,12,20H,6-8H2,1H3,(H,17,18) |
| InChIKey | FUIFBEGQVQEFRJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|