C12H15N2NaO5S2 — CID 88699188
sodium (5R,6S)-6-(1-hydroxyethyl)-3-(2-hydroxyiminobutylsulfanyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 88699188) has the molecular formula C12H15N2NaO5S2 and a molecular weight of 354.39 g/mol. Its IUPAC name is sodium (5R,6S)-6-(1-hydroxyethyl)-3-(2-hydroxyiminobutylsulfanyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | sodium (5R,6S)-6-(1-hydroxyethyl)-3-(2-hydroxyiminobutylsulfanyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88699188 |
| Molecular Formula | C12H15N2NaO5S2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | sodium (5R,6S)-6-(1-hydroxyethyl)-3-(2-hydroxyiminobutylsulfanyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CCC(CSC1=C(C(=O)[O-])N2C(=O)[C@H](C(C)O)[C@H]2S1)=NO.[Na+] |
| InChI | InChI=1S/C12H16N2O5S2.Na/c1-3-6(13-19)4-20-12-8(11(17)18)14-9(16)7(5(2)15)10(14)21-12;/h5,7,10,15,19H,3-4H2,1-2H3,(H,17,18);/q;+1/p-1/t5?,7-,10+;/m0./s1 |
| InChIKey | HEQSINRQDHFTMV-FYPUWEAISA-M |
| XLogP | -3.21 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|