C15H21FN2O2 — CID 88700485
N-[(2-fluorophenyl)methoxy]-N-(1-methylpiperidin-2-yl)acetamide (PubChem CID 88700485) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methoxy]-N-(1-methylpiperidin-2-yl)acetamide.
| Compound Name | N-[(2-fluorophenyl)methoxy]-N-(1-methylpiperidin-2-yl)acetamide |
|---|---|
| PubChem CID | 88700485 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-[(2-fluorophenyl)methoxy]-N-(1-methylpiperidin-2-yl)acetamide |
| SMILES | CC(=O)N(OCc1ccccc1F)C1CCCCN1C |
| InChI | InChI=1S/C15H21FN2O2/c1-12(19)18(15-9-5-6-10-17(15)2)20-11-13-7-3-4-8-14(13)16/h3-4,7-8,15H,5-6,9-11H2,1-2H3 |
| InChIKey | WNZWKIIFZTXPKL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|