C15H10F7NO — CID 88701681
N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(trifluoromethyl)aniline (PubChem CID 88701681) has the molecular formula C15H10F7NO and a molecular weight of 353.24 g/mol. Its IUPAC name is N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(trifluoromethyl)aniline.
| Compound Name | N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 88701681 |
| Molecular Formula | C15H10F7NO |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(trifluoromethyl)aniline |
| SMILES | FC(F)C(F)(F)Oc1ccc(Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F7NO/c16-13(17)15(21,22)24-10-7-5-9(6-8-10)23-12-4-2-1-3-11(12)14(18,19)20/h1-8,13,23H |
| InChIKey | LSDKTIUJXXDVKN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|