C17H15NO6S2 — CID 88702310
7-hydroxy-6-[(2-methylphenyl)sulfamoyl]naphthalene-2-sulfonic acid (PubChem CID 88702310) has the molecular formula C17H15NO6S2 and a molecular weight of 393.44 g/mol. Its IUPAC name is 7-hydroxy-6-[(2-methylphenyl)sulfamoyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-hydroxy-6-[(2-methylphenyl)sulfamoyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 88702310 |
| Molecular Formula | C17H15NO6S2 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 7-hydroxy-6-[(2-methylphenyl)sulfamoyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1ccccc1NS(=O)(=O)c1cc2ccc(S(=O)(=O)O)cc2cc1O |
| InChI | InChI=1S/C17H15NO6S2/c1-11-4-2-3-5-15(11)18-25(20,21)17-10-12-6-7-14(26(22,23)24)8-13(12)9-16(17)19/h2-10,18-19H,1H3,(H,22,23,24) |
| InChIKey | VBRXFPVMZWSFML-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|