C27H25F5N2O4 — CID 88704851
methyl 7-[4-(2-hydroxyphenyl)butyl]-2-methyl-5-oxo-4-(2,3,4,5,6-pentafluorophenyl)-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate (PubChem CID 88704851) has the molecular formula C27H25F5N2O4 and a molecular weight of 536.50 g/mol. Its IUPAC name is methyl 7-[4-(2-hydroxyphenyl)butyl]-2-methyl-5-oxo-4-(2,3,4,5,6-pentafluorophenyl)-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate.
| Compound Name | methyl 7-[4-(2-hydroxyphenyl)butyl]-2-methyl-5-oxo-4-(2,3,4,5,6-pentafluorophenyl)-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 88704851 |
| Molecular Formula | C27H25F5N2O4 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | methyl 7-[4-(2-hydroxyphenyl)butyl]-2-methyl-5-oxo-4-(2,3,4,5,6-pentafluorophenyl)-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)CN(CCCCc3ccccc3O)C2)C1c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C27H25F5N2O4/c1-13-18(27(37)38-2)20(21-22(28)24(30)26(32)25(31)23(21)29)19-15(33-13)11-34(12-17(19)36)10-6-5-8-14-7-3-4-9-16(14)35/h3-4,7,9,20,33,35H,5-6,8,10-12H2,1-2H3 |
| InChIKey | DXRGXKHEZQIJEO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|