C8H15FN2O2 — CID 88705955
(E)-2,6-diamino-2-(fluoromethyl)-5-methylhex-4-enoic acid (PubChem CID 88705955) has the molecular formula C8H15FN2O2 and a molecular weight of 190.22 g/mol. Its IUPAC name is (E)-2,6-diamino-2-(fluoromethyl)-5-methylhex-4-enoic acid.
| Compound Name | (E)-2,6-diamino-2-(fluoromethyl)-5-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 88705955 |
| Molecular Formula | C8H15FN2O2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (E)-2,6-diamino-2-(fluoromethyl)-5-methylhex-4-enoic acid |
| SMILES | C/C(=C\CC(N)(CF)C(=O)O)CN |
| InChI | InChI=1S/C8H15FN2O2/c1-6(4-10)2-3-8(11,5-9)7(12)13/h2H,3-5,10-11H2,1H3,(H,12,13)/b6-2+ |
| InChIKey | AGXBWHUYUFNFBM-QHHAFSJGSA-N |
| XLogP | 0.03 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|