C12H18N2O2 — CID 88708309
1,2-diisocyanato-1-methyl-2-propan-2-ylcyclohexane (PubChem CID 88708309) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 1,2-diisocyanato-1-methyl-2-propan-2-ylcyclohexane.
| Compound Name | 1,2-diisocyanato-1-methyl-2-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 88708309 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1,2-diisocyanato-1-methyl-2-propan-2-ylcyclohexane |
| SMILES | CC(C)C1(N=C=O)CCCCC1(C)N=C=O |
| InChI | InChI=1S/C12H18N2O2/c1-10(2)12(14-9-16)7-5-4-6-11(12,3)13-8-15/h10H,4-7H2,1-3H3 |
| InChIKey | JTNPYGHNCSQORH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|