C25H28N6O6 — CID 88708920
5-amino-6-nitrospiro[1H-indole-3,1'-cyclohexane]-2-one;5-amino-6-nitrospiro[1H-indole-3,1'-cyclopentane]-2-one (PubChem CID 88708920) has the molecular formula C25H28N6O6 and a molecular weight of 508.54 g/mol. Its IUPAC name is 5-amino-6-nitrospiro[1H-indole-3,1'-cyclohexane]-2-one;5-amino-6-nitrospiro[1H-indole-3,1'-cyclopentane]-2-one.
| Compound Name | 5-amino-6-nitrospiro[1H-indole-3,1'-cyclohexane]-2-one;5-amino-6-nitrospiro[1H-indole-3,1'-cyclopentane]-2-one |
|---|---|
| PubChem CID | 88708920 |
| Molecular Formula | C25H28N6O6 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 5-amino-6-nitrospiro[1H-indole-3,1'-cyclohexane]-2-one;5-amino-6-nitrospiro[1H-indole-3,1'-cyclopentane]-2-one |
| SMILES | Nc1cc2c(cc1[N+](=O)[O-])NC(=O)C21CCCC1.Nc1cc2c(cc1[N+](=O)[O-])NC(=O)C21CCCCC1 |
| InChI | InChI=1S/C13H15N3O3.C12H13N3O3/c14-9-6-8-10(7-11(9)16(18)19)15-12(17)13(8)4-2-1-3-5-13;13-8-5-7-9(6-10(8)15(17)18)14-11(16)12(7)3-1-2-4-12/h6-7H,1-5,14H2,(H,15,17);5-6H,1-4,13H2,(H,14,16) |
| InChIKey | GXFOYVOGNIDOSU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 196.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|