C9H19NO6P+ — CID 88709203
butane;[(2-ethoxy-2-oxoacetyl)amino]methoxy-hydroxy-oxophosphanium (PubChem CID 88709203) has the molecular formula C9H19NO6P+ and a molecular weight of 268.23 g/mol. Its IUPAC name is butane;[(2-ethoxy-2-oxoacetyl)amino]methoxy-hydroxy-oxophosphanium.
| Compound Name | butane;[(2-ethoxy-2-oxoacetyl)amino]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 88709203 |
| Molecular Formula | C9H19NO6P+ |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | butane;[(2-ethoxy-2-oxoacetyl)amino]methoxy-hydroxy-oxophosphanium |
| SMILES | CCCC.CCOC(=O)C(=O)NCO[P+](=O)O |
| InChI | InChI=1S/C5H8NO6P.C4H10/c1-2-11-5(8)4(7)6-3-12-13(9)10;1-3-4-2/h2-3H2,1H3,(H-,6,7,9,10);3-4H2,1-2H3/p+1 |
| InChIKey | XYMIUBHVZXSHDF-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|