C18H22O2 — CID 88710522
3-phenyl-4,5-di(propan-2-yl)benzene-1,2-diol (PubChem CID 88710522) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 3-phenyl-4,5-di(propan-2-yl)benzene-1,2-diol.
| Compound Name | 3-phenyl-4,5-di(propan-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 88710522 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 3-phenyl-4,5-di(propan-2-yl)benzene-1,2-diol |
| SMILES | CC(C)c1cc(O)c(O)c(-c2ccccc2)c1C(C)C |
| InChI | InChI=1S/C18H22O2/c1-11(2)14-10-15(19)18(20)17(16(14)12(3)4)13-8-6-5-7-9-13/h5-12,19-20H,1-4H3 |
| InChIKey | XIWZVJTUPLJTPD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|