About 2-phenyl-3,4-di(propan-2-yl)benzoic acid
2-phenyl-3,4-di(propan-2-yl)benzoic acid (PubChem CID 70035645) has the molecular formula C19H22O2
and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-phenyl-3,4-di(propan-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 2-phenyl-3,4-di(propan-2-yl)benzoic acid |
| PubChem CID | 70035645 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-phenyl-3,4-di(propan-2-yl)benzoic acid |
| SMILES | CC(C)c1ccc(C(=O)O)c(-c2ccccc2)c1C(C)C |
| InChI | InChI=1S/C19H22O2/c1-12(2)15-10-11-16(19(20)21)18(17(15)13(3)4)14-8-6-5-7-9-14/h5-13H,1-4H3,(H,20,21) |
| InChIKey | CQGVEFZKBSMEGI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenyl-3,4-di(propan-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3,4-di(propan-2-yl)benzoic acid?
The IUPAC name of 2-phenyl-3,4-di(propan-2-yl)benzoic acid (CID 70035645) is 2-phenyl-3,4-di(propan-2-yl)benzoic acid.
What is the SMILES notation for 2-phenyl-3,4-di(propan-2-yl)benzoic acid?
The canonical SMILES for 2-phenyl-3,4-di(propan-2-yl)benzoic acid is CC(C)c1ccc(C(=O)O)c(-c2ccccc2)c1C(C)C.
What is the InChIKey of 2-phenyl-3,4-di(propan-2-yl)benzoic acid?
The InChIKey is CQGVEFZKBSMEGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O2/c1-12(2)15-10-11-16(19(20)21)18(17(15)13(3)4)14-8-6-5-7-9-14/h5-13H,1-4H3,(H,20,21).
What are the key properties of 2-phenyl-3,4-di(propan-2-yl)benzoic acid?
2-phenyl-3,4-di(propan-2-yl)benzoic acid has a molecular weight of 282.38 g/mol, XLogP of 5.30, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3,4-di(propan-2-yl)benzoic acid is sourced from PubChem (CID 70035645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).