C17H25F6NO — CID 88716938
2-(4,5-dipentyl-1H-pyrrol-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 88716938) has the molecular formula C17H25F6NO and a molecular weight of 373.38 g/mol. Its IUPAC name is 2-(4,5-dipentyl-1H-pyrrol-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(4,5-dipentyl-1H-pyrrol-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 88716938 |
| Molecular Formula | C17H25F6NO |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-(4,5-dipentyl-1H-pyrrol-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCCCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)[nH]c1CCCCC |
| InChI | InChI=1S/C17H25F6NO/c1-3-5-7-9-12-11-14(24-13(12)10-8-6-4-2)15(25,16(18,19)20)17(21,22)23/h11,24-25H,3-10H2,1-2H3 |
| InChIKey | ZPPUIPDXTXDKGD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|