C19H28O12 — CID 88717516
(2R,3S,4S,5R,6R)-2-(benzylperoxymethyl)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxyoxane-3,4,5-triol (PubChem CID 88717516) has the molecular formula C19H28O12 and a molecular weight of 448.42 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(benzylperoxymethyl)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(benzylperoxymethyl)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 88717516 |
| Molecular Formula | C19H28O12 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(benzylperoxymethyl)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxyoxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](COOCc3ccccc3)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H28O12/c20-6-11-14(23)17(26)19(9-21,30-11)31-18-16(25)15(24)13(22)12(29-18)8-28-27-7-10-4-2-1-3-5-10/h1-5,11-18,20-26H,6-9H2/t11-,12-,13-,14-,15+,16-,17+,18-,19+/m1/s1 |
| InChIKey | COHZINHIXSFTHJ-ZSOARRGESA-N |
| XLogP | -3.24 |
| TPSA | 187.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|