C15H17Cl5O2 — CID 88718254
2,5,7,7-tetrachloro-7-(4-chlorophenyl)-4,4-dimethylheptanoic acid (PubChem CID 88718254) has the molecular formula C15H17Cl5O2 and a molecular weight of 406.56 g/mol. Its IUPAC name is 2,5,7,7-tetrachloro-7-(4-chlorophenyl)-4,4-dimethylheptanoic acid.
| Compound Name | 2,5,7,7-tetrachloro-7-(4-chlorophenyl)-4,4-dimethylheptanoic acid |
|---|---|
| PubChem CID | 88718254 |
| Molecular Formula | C15H17Cl5O2 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | 2,5,7,7-tetrachloro-7-(4-chlorophenyl)-4,4-dimethylheptanoic acid |
| SMILES | CC(C)(CC(Cl)C(=O)O)C(Cl)CC(Cl)(Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17Cl5O2/c1-14(2,7-11(17)13(21)22)12(18)8-15(19,20)9-3-5-10(16)6-4-9/h3-6,11-12H,7-8H2,1-2H3,(H,21,22) |
| InChIKey | BUKBQWOMNNBIGT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|