C16H20Cl4O3 — CID 88732738
2,5,7,7-tetrachloro-7-(4-methoxyphenyl)-4,4-dimethylheptanoic acid (PubChem CID 88732738) has the molecular formula C16H20Cl4O3 and a molecular weight of 402.15 g/mol. Its IUPAC name is 2,5,7,7-tetrachloro-7-(4-methoxyphenyl)-4,4-dimethylheptanoic acid.
| Compound Name | 2,5,7,7-tetrachloro-7-(4-methoxyphenyl)-4,4-dimethylheptanoic acid |
|---|---|
| PubChem CID | 88732738 |
| Molecular Formula | C16H20Cl4O3 |
| Molecular Weight | 402.15 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 2,5,7,7-tetrachloro-7-(4-methoxyphenyl)-4,4-dimethylheptanoic acid |
| SMILES | COc1ccc(C(Cl)(Cl)CC(Cl)C(C)(C)CC(Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C16H20Cl4O3/c1-15(2,8-12(17)14(21)22)13(18)9-16(19,20)10-4-6-11(23-3)7-5-10/h4-7,12-13H,8-9H2,1-3H3,(H,21,22) |
| InChIKey | ITESAMIMXLTHOI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.15 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|