C22H45O5PS — CID 88720640
2-(hexadecylsulfanylmethyl)penta-2,3-dien-1-ol;phosphoric acid (PubChem CID 88720640) has the molecular formula C22H45O5PS and a molecular weight of 452.64 g/mol. Its IUPAC name is 2-(hexadecylsulfanylmethyl)penta-2,3-dien-1-ol;phosphoric acid.
| Compound Name | 2-(hexadecylsulfanylmethyl)penta-2,3-dien-1-ol;phosphoric acid |
|---|---|
| PubChem CID | 88720640 |
| Molecular Formula | C22H45O5PS |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 2-(hexadecylsulfanylmethyl)penta-2,3-dien-1-ol;phosphoric acid |
| SMILES | CC=C=C(CO)CSCCCCCCCCCCCCCCCC.O=P(O)(O)O |
| InChI | InChI=1S/C22H42OS.H3O4P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19-24-21-22(20-23)18-4-2;1-5(2,3)4/h4,23H,3,5-17,19-21H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | ZZCLPKQIADRXRB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|