C22H42OS — CID 88720641
2-(hexadecylsulfanylmethyl)penta-2,3-dien-1-ol (PubChem CID 88720641) has the molecular formula C22H42OS and a molecular weight of 354.64 g/mol. Its IUPAC name is 2-(hexadecylsulfanylmethyl)penta-2,3-dien-1-ol.
| Compound Name | 2-(hexadecylsulfanylmethyl)penta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 88720641 |
| Molecular Formula | C22H42OS |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | 2-(hexadecylsulfanylmethyl)penta-2,3-dien-1-ol |
| SMILES | CC=C=C(CO)CSCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C22H42OS/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19-24-21-22(20-23)18-4-2/h4,23H,3,5-17,19-21H2,1-2H3 |
| InChIKey | CXASTEDLIWUNTJ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|