C12H24N4 — CID 88726763
2-cyano-1,1-bis(3-methylbutyl)guanidine (PubChem CID 88726763) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-cyano-1,1-bis(3-methylbutyl)guanidine.
| Compound Name | 2-cyano-1,1-bis(3-methylbutyl)guanidine |
|---|---|
| PubChem CID | 88726763 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 2-cyano-1,1-bis(3-methylbutyl)guanidine |
| SMILES | CC(C)CCN(CCC(C)C)/C(N)=N/C#N |
| InChI | InChI=1S/C12H24N4/c1-10(2)5-7-16(8-6-11(3)4)12(14)15-9-13/h10-11H,5-8H2,1-4H3,(H2,14,15) |
| InChIKey | JWXSMXLVCRGNIY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 65.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|