About O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate
O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate (PubChem CID 88726882) has the molecular formula C15H13ClN2OS
and a molecular weight of 304.80 g/mol. Its IUPAC name is O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate.
Molecular Properties
| Compound Name | O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate |
| PubChem CID | 88726882 |
| Molecular Formula | C15H13ClN2OS |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate |
| SMILES | NC(=NC(=S)OCc1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C15H13ClN2OS/c16-13-9-5-4-8-12(13)14(17)18-15(20)19-10-11-6-2-1-3-7-11/h1-9H,10H2,(H2,17,18,20) |
| InChIKey | BCQAPNQQHRYNAG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate?
The IUPAC name of O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate (CID 88726882) is O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate.
What is the SMILES notation for O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate?
The canonical SMILES for O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate is NC(=NC(=S)OCc1ccccc1)c1ccccc1Cl.
What is the InChIKey of O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate?
The InChIKey is BCQAPNQQHRYNAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN2OS/c16-13-9-5-4-8-12(13)14(17)18-15(20)19-10-11-6-2-1-3-7-11/h1-9H,10H2,(H2,17,18,20).
What are the key properties of O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate?
O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate has a molecular weight of 304.80 g/mol, XLogP of 3.55, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-benzyl N-[amino-(2-chlorophenyl)methylidene]carbamothioate is sourced from PubChem (CID 88726882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).