C20H30N6O10S2Si2 — CID 88726914
N-diazo-4-trimethoxysilylbenzenesulfonamide;N-diazo-2-(2-trimethoxysilylethyl)benzenesulfonamide (PubChem CID 88726914) has the molecular formula C20H30N6O10S2Si2 and a molecular weight of 634.80 g/mol. Its IUPAC name is N-diazo-4-trimethoxysilylbenzenesulfonamide;N-diazo-2-(2-trimethoxysilylethyl)benzenesulfonamide.
| Compound Name | N-diazo-4-trimethoxysilylbenzenesulfonamide;N-diazo-2-(2-trimethoxysilylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 88726914 |
| Molecular Formula | C20H30N6O10S2Si2 |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 634.10 |
| IUPAC Name | N-diazo-4-trimethoxysilylbenzenesulfonamide;N-diazo-2-(2-trimethoxysilylethyl)benzenesulfonamide |
| SMILES | CO[Si](CCc1ccccc1S(=O)(=O)N=[N+]=[N-])(OC)OC.CO[Si](OC)(OC)c1ccc(S(=O)(=O)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C11H17N3O5SSi.C9H13N3O5SSi/c1-17-21(18-2,19-3)9-8-10-6-4-5-7-11(10)20(15,16)14-13-12;1-15-19(16-2,17-3)9-6-4-8(5-7-9)18(13,14)12-11-10/h4-7H,8-9H2,1-3H3;4-7H,1-3H3 |
| InChIKey | GAHMPUCJMQILIZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 221.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|