C9H15Cl5 — CID 88732149
2,3,4,6-tetrachloro-4-(2-chloroethyl)heptane (PubChem CID 88732149) has the molecular formula C9H15Cl5 and a molecular weight of 300.48 g/mol. Its IUPAC name is 2,3,4,6-tetrachloro-4-(2-chloroethyl)heptane.
| Compound Name | 2,3,4,6-tetrachloro-4-(2-chloroethyl)heptane |
|---|---|
| PubChem CID | 88732149 |
| Molecular Formula | C9H15Cl5 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | 2,3,4,6-tetrachloro-4-(2-chloroethyl)heptane |
| SMILES | CC(Cl)CC(Cl)(CCCl)C(Cl)C(C)Cl |
| InChI | InChI=1S/C9H15Cl5/c1-6(11)5-9(14,3-4-10)8(13)7(2)12/h6-8H,3-5H2,1-2H3 |
| InChIKey | BJMFCOUULQONBL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|