C18H17NO6S2 — CID 88732544
(2S,5R,6R)-3,3-dimethyl-6-naphthalen-2-ylsulfonyloxy-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 88732544) has the molecular formula C18H17NO6S2 and a molecular weight of 407.47 g/mol. Its IUPAC name is (2S,5R,6R)-3,3-dimethyl-6-naphthalen-2-ylsulfonyloxy-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-3,3-dimethyl-6-naphthalen-2-ylsulfonyloxy-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 88732544 |
| Molecular Formula | C18H17NO6S2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | (2S,5R,6R)-3,3-dimethyl-6-naphthalen-2-ylsulfonyloxy-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](OS(=O)(=O)c3ccc4ccccc4c3)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C18H17NO6S2/c1-18(2)14(17(21)22)19-15(20)13(16(19)26-18)25-27(23,24)12-8-7-10-5-3-4-6-11(10)9-12/h3-9,13-14,16H,1-2H3,(H,21,22)/t13-,14+,16-/m1/s1 |
| InChIKey | OBVFONIRYQILSS-IJEWVQPXSA-N |
| XLogP | 2.06 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|