C8H9NNa2O7S2 — CID 13470842
disodium;(2S,5R,6R)-3,3-dimethyl-7-oxo-6-sulfonatooxy-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 13470842) has the molecular formula C8H9NNa2O7S2 and a molecular weight of 341.27 g/mol. Its IUPAC name is disodium;(2S,5R,6R)-3,3-dimethyl-7-oxo-6-sulfonatooxy-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | disodium;(2S,5R,6R)-3,3-dimethyl-7-oxo-6-sulfonatooxy-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 13470842 |
| Molecular Formula | C8H9NNa2O7S2 |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | disodium;(2S,5R,6R)-3,3-dimethyl-7-oxo-6-sulfonatooxy-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@@H]2[C@H](OS(=O)(=O)[O-])C(=O)N2[C@H]1C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H11NO7S2.2Na/c1-8(2)4(7(11)12)9-5(10)3(6(9)17-8)16-18(13,14)15;;/h3-4,6H,1-2H3,(H,11,12)(H,13,14,15);;/q;2*+1/p-2/t3-,4+,6-;;/m1../s1 |
| InChIKey | QNIJJUBAVJXAAK-SKNCTXARSA-L |
| XLogP | -8.35 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | -8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|