C14H14NNaO6S2 — CID 88732507
sodium (2S,5R,6R)-6-(benzenesulfonyloxy)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88732507) has the molecular formula C14H14NNaO6S2 and a molecular weight of 379.39 g/mol. Its IUPAC name is sodium (2S,5R,6R)-6-(benzenesulfonyloxy)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-6-(benzenesulfonyloxy)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88732507 |
| Molecular Formula | C14H14NNaO6S2 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | sodium (2S,5R,6R)-6-(benzenesulfonyloxy)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@@H]2[C@H](OS(=O)(=O)c3ccccc3)C(=O)N2[C@H]1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H15NO6S2.Na/c1-14(2)10(13(17)18)15-11(16)9(12(15)22-14)21-23(19,20)8-6-4-3-5-7-8;/h3-7,9-10,12H,1-2H3,(H,17,18);/q;+1/p-1/t9-,10+,12-;/m1./s1 |
| InChIKey | WGALYKDMQOGJMK-QQQUOLKDSA-M |
| XLogP | -3.42 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|