C15H16NNaO8S2 — CID 88732501
sodium (2S,5R,6R)-3,3-dimethyl-6-(4-methylphenyl)sulfonyloxy-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88732501) has the molecular formula C15H16NNaO8S2 and a molecular weight of 425.42 g/mol. Its IUPAC name is sodium (2S,5R,6R)-3,3-dimethyl-6-(4-methylphenyl)sulfonyloxy-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-3,3-dimethyl-6-(4-methylphenyl)sulfonyloxy-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88732501 |
| Molecular Formula | C15H16NNaO8S2 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | sodium (2S,5R,6R)-3,3-dimethyl-6-(4-methylphenyl)sulfonyloxy-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2C(=O)N3[C@@H](C(=O)[O-])C(C)(C)S(=O)(=O)[C@H]23)cc1.[Na+] |
| InChI | InChI=1S/C15H17NO8S2.Na/c1-8-4-6-9(7-5-8)26(22,23)24-10-12(17)16-11(14(18)19)15(2,3)25(20,21)13(10)16;/h4-7,10-11,13H,1-3H3,(H,18,19);/q;+1/p-1/t10-,11+,13-;/m1./s1 |
| InChIKey | YETSYCSHWHYZQP-GYBQEXSMSA-M |
| XLogP | -4.43 |
| TPSA | 137.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | -4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|