C18H23NO9S2 — CID 10647695
ethyl (3R,6S,7S,8S,9R,9aS)-7,8,9-trihydroxy-6-(4-methylphenyl)sulfonyloxy-5-oxo-3,6,7,8,9,9a-hexahydro-2H-[1,3]thiazolo[3,2-a]azepine-3-carboxylate (PubChem CID 10647695) has the molecular formula C18H23NO9S2 and a molecular weight of 461.51 g/mol. Its IUPAC name is ethyl (3R,6S,7S,8S,9R,9aS)-7,8,9-trihydroxy-6-(4-methylphenyl)sulfonyloxy-5-oxo-3,6,7,8,9,9a-hexahydro-2H-[1,3]thiazolo[3,2-a]azepine-3-carboxylate.
| Compound Name | ethyl (3R,6S,7S,8S,9R,9aS)-7,8,9-trihydroxy-6-(4-methylphenyl)sulfonyloxy-5-oxo-3,6,7,8,9,9a-hexahydro-2H-[1,3]thiazolo[3,2-a]azepine-3-carboxylate |
|---|---|
| PubChem CID | 10647695 |
| Molecular Formula | C18H23NO9S2 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | ethyl (3R,6S,7S,8S,9R,9aS)-7,8,9-trihydroxy-6-(4-methylphenyl)sulfonyloxy-5-oxo-3,6,7,8,9,9a-hexahydro-2H-[1,3]thiazolo[3,2-a]azepine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CS[C@H]2[C@H](O)[C@@H](O)[C@H](O)[C@H](OS(=O)(=O)c3ccc(C)cc3)C(=O)N12 |
| InChI | InChI=1S/C18H23NO9S2/c1-3-27-18(24)11-8-29-17-14(22)12(20)13(21)15(16(23)19(11)17)28-30(25,26)10-6-4-9(2)5-7-10/h4-7,11-15,17,20-22H,3,8H2,1-2H3/t11-,12-,13-,14+,15-,17-/m0/s1 |
| InChIKey | UAOQGQAXNINHLR-KNJYOJCESA-N |
| XLogP | -1.00 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|