C38H40ClN3O9S2 — CID 131716959
1-benzyl-3-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione;ethyl (2R)-1-(4-methylphenyl)sulfonyl-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate (PubChem CID 131716959) has the molecular formula C38H40ClN3O9S2 and a molecular weight of 782.34 g/mol. Its IUPAC name is 1-benzyl-3-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione;ethyl (2R)-1-(4-methylphenyl)sulfonyl-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate.
| Compound Name | 1-benzyl-3-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione;ethyl (2R)-1-(4-methylphenyl)sulfonyl-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 131716959 |
| Molecular Formula | C38H40ClN3O9S2 |
| Molecular Weight | 782.34 g/mol |
| Exact Mass | 781.19 |
| IUPAC Name | 1-benzyl-3-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione;ethyl (2R)-1-(4-methylphenyl)sulfonyl-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate |
| SMILES | CC1C(=O)N(c2ccc(Cl)cc2)C(=O)N1Cc1ccccc1.CCOC(=O)[C@H]1CC(OS(=O)(=O)c2ccc(C)cc2)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25NO7S2.C17H15ClN2O2/c1-4-28-21(23)20-13-17(29-31(26,27)19-11-7-16(3)8-12-19)14-22(20)30(24,25)18-9-5-15(2)6-10-18;1-12-16(21)20(15-9-7-14(18)8-10-15)17(22)19(12)11-13-5-3-2-4-6-13/h5-12,17,20H,4,13-14H2,1-3H3;2-10,12H,11H2,1H3/t17?,20-;/m1./s1 |
| InChIKey | OEEHNCJRUPUTDV-NJPRBYKHSA-N |
| XLogP | 6.10 |
| TPSA | 147.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.34 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|