C13H19NO5S2 — CID 102465953
[(2R,3S)-2-methyl-1-methylsulfonylpyrrolidin-3-yl] 4-methylbenzenesulfonate (PubChem CID 102465953) has the molecular formula C13H19NO5S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is [(2R,3S)-2-methyl-1-methylsulfonylpyrrolidin-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-2-methyl-1-methylsulfonylpyrrolidin-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102465953 |
| Molecular Formula | C13H19NO5S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | [(2R,3S)-2-methyl-1-methylsulfonylpyrrolidin-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CCN(S(C)(=O)=O)[C@@H]2C)cc1 |
| InChI | InChI=1S/C13H19NO5S2/c1-10-4-6-12(7-5-10)21(17,18)19-13-8-9-14(11(13)2)20(3,15)16/h4-7,11,13H,8-9H2,1-3H3/t11-,13+/m1/s1 |
| InChIKey | MTGWIVVBXLCZTJ-YPMHNXCESA-N |
| XLogP | 1.12 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|