C6H8Br3NaO3 — CID 88732733
sodium (1,1,1-tribromo-3-methylbutan-2-yl) carbonate (PubChem CID 88732733) has the molecular formula C6H8Br3NaO3 and a molecular weight of 390.83 g/mol. Its IUPAC name is sodium (1,1,1-tribromo-3-methylbutan-2-yl) carbonate.
| Compound Name | sodium (1,1,1-tribromo-3-methylbutan-2-yl) carbonate |
|---|---|
| PubChem CID | 88732733 |
| Molecular Formula | C6H8Br3NaO3 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 387.79 |
| IUPAC Name | sodium (1,1,1-tribromo-3-methylbutan-2-yl) carbonate |
| SMILES | CC(C)C(OC(=O)[O-])C(Br)(Br)Br.[Na+] |
| InChI | InChI=1S/C6H9Br3O3.Na/c1-3(2)4(6(7,8)9)12-5(10)11;/h3-4H,1-2H3,(H,10,11);/q;+1/p-1 |
| InChIKey | KVQXYMKICSULOQ-UHFFFAOYSA-M |
| XLogP | -0.79 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|