C11H17N3 — CID 88734285
N-diazenylundeca-2,4,6-trien-1-imine (PubChem CID 88734285) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N-diazenylundeca-2,4,6-trien-1-imine.
| Compound Name | N-diazenylundeca-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 88734285 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N-diazenylundeca-2,4,6-trien-1-imine |
| SMILES | [H]/N=N/N=C/C=CC=CC=CCCCC |
| InChI | InChI=1S/C11H17N3/c1-2-3-4-5-6-7-8-9-10-11-13-14-12/h5-12H,2-4H2,1H3/b6-5?,8-7?,10-9?,13-11+,14-12+ |
| InChIKey | QMVNIKHAGYJEKJ-UUPDADFLSA-N |
| XLogP | 3.86 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|