About (2-methoxyanilino) 4-aminobenzenesulfonate
(2-methoxyanilino) 4-aminobenzenesulfonate (PubChem CID 88734298) has the molecular formula C13H14N2O4S
and a molecular weight of 294.33 g/mol. Its IUPAC name is (2-methoxyanilino) 4-aminobenzenesulfonate.
Molecular Properties
| Compound Name | (2-methoxyanilino) 4-aminobenzenesulfonate |
| PubChem CID | 88734298 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | (2-methoxyanilino) 4-aminobenzenesulfonate |
| SMILES | COc1ccccc1NOS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H14N2O4S/c1-18-13-5-3-2-4-12(13)15-19-20(16,17)11-8-6-10(14)7-9-11/h2-9,15H,14H2,1H3 |
| InChIKey | CHUDAVIDRZORFQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxyanilino) 4-aminobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxyanilino) 4-aminobenzenesulfonate?
The IUPAC name of (2-methoxyanilino) 4-aminobenzenesulfonate (CID 88734298) is (2-methoxyanilino) 4-aminobenzenesulfonate.
What is the SMILES notation for (2-methoxyanilino) 4-aminobenzenesulfonate?
The canonical SMILES for (2-methoxyanilino) 4-aminobenzenesulfonate is COc1ccccc1NOS(=O)(=O)c1ccc(N)cc1.
What is the InChIKey of (2-methoxyanilino) 4-aminobenzenesulfonate?
The InChIKey is CHUDAVIDRZORFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4S/c1-18-13-5-3-2-4-12(13)15-19-20(16,17)11-8-6-10(14)7-9-11/h2-9,15H,14H2,1H3.
What are the key properties of (2-methoxyanilino) 4-aminobenzenesulfonate?
(2-methoxyanilino) 4-aminobenzenesulfonate has a molecular weight of 294.33 g/mol, XLogP of 2.01, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxyanilino) 4-aminobenzenesulfonate is sourced from PubChem (CID 88734298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).