C23H28N2O6 — CID 88734816
(Z)-2-methyl-3-[2,3,4,5-tetrakis(oxiran-2-ylmethyl)phenyl]but-2-enediamide (PubChem CID 88734816) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is (Z)-2-methyl-3-[2,3,4,5-tetrakis(oxiran-2-ylmethyl)phenyl]but-2-enediamide.
| Compound Name | (Z)-2-methyl-3-[2,3,4,5-tetrakis(oxiran-2-ylmethyl)phenyl]but-2-enediamide |
|---|---|
| PubChem CID | 88734816 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (Z)-2-methyl-3-[2,3,4,5-tetrakis(oxiran-2-ylmethyl)phenyl]but-2-enediamide |
| SMILES | C/C(C(N)=O)=C(/C(N)=O)c1cc(CC2CO2)c(CC2CO2)c(CC2CO2)c1CC1CO1 |
| InChI | InChI=1S/C23H28N2O6/c1-11(22(24)26)21(23(25)27)20-3-12(2-13-7-28-13)17(4-14-8-29-14)18(5-15-9-30-15)19(20)6-16-10-31-16/h3,13-16H,2,4-10H2,1H3,(H2,24,26)(H2,25,27)/b21-11- |
| InChIKey | DEBQJCXVAWVYAK-NHDPSOOVSA-N |
| XLogP | 0.20 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|