C17H13N3O2S — CID 88737335
4-methyl-8-phenyl-8λ4-thia-3,4,7-triazatricyclo[7.4.0.02,6]trideca-1(13),2,5,7,9,11-hexaene-5-carboxylic acid (PubChem CID 88737335) has the molecular formula C17H13N3O2S and a molecular weight of 323.38 g/mol. Its IUPAC name is 4-methyl-8-phenyl-8λ4-thia-3,4,7-triazatricyclo[7.4.0.02,6]trideca-1(13),2,5,7,9,11-hexaene-5-carboxylic acid.
| Compound Name | 4-methyl-8-phenyl-8λ4-thia-3,4,7-triazatricyclo[7.4.0.02,6]trideca-1(13),2,5,7,9,11-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 88737335 |
| Molecular Formula | C17H13N3O2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 4-methyl-8-phenyl-8λ4-thia-3,4,7-triazatricyclo[7.4.0.02,6]trideca-1(13),2,5,7,9,11-hexaene-5-carboxylic acid |
| SMILES | Cn1nc2c(c1C(=O)O)N=S(c1ccccc1)c1ccccc1-2 |
| InChI | InChI=1S/C17H13N3O2S/c1-20-16(17(21)22)15-14(18-20)12-9-5-6-10-13(12)23(19-15)11-7-3-2-4-8-11/h2-10H,1H3,(H,21,22) |
| InChIKey | NDIZVJSLGGUQGZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |