C21H24ClFNO5+ — CID 88741317
pentyl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydro-2H-indol-1-ium-2-yl)-4-fluorophenoxy]acetate (PubChem CID 88741317) has the molecular formula C21H24ClFNO5+ and a molecular weight of 424.88 g/mol. Its IUPAC name is pentyl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydro-2H-indol-1-ium-2-yl)-4-fluorophenoxy]acetate.
| Compound Name | pentyl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydro-2H-indol-1-ium-2-yl)-4-fluorophenoxy]acetate |
|---|---|
| PubChem CID | 88741317 |
| Molecular Formula | C21H24ClFNO5+ |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | pentyl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydro-2H-indol-1-ium-2-yl)-4-fluorophenoxy]acetate |
| SMILES | CCCCCOC(=O)COc1cc(C2C(=O)C3=C(CCCC3)[N+]2=O)c(F)cc1Cl |
| InChI | InChI=1S/C21H24ClFNO5/c1-2-3-6-9-28-19(25)12-29-18-10-14(16(23)11-15(18)22)20-21(26)13-7-4-5-8-17(13)24(20)27/h10-11,20H,2-9,12H2,1H3/q+1 |
| InChIKey | ARGVRBKJAOXPAI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|