C20H20O5S — CID 88741781
[(2S)-1-hydroxy-3-(6-methoxynaphthalen-2-yl)propan-2-yl] benzenesulfonate (PubChem CID 88741781) has the molecular formula C20H20O5S and a molecular weight of 372.44 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-(6-methoxynaphthalen-2-yl)propan-2-yl] benzenesulfonate.
| Compound Name | [(2S)-1-hydroxy-3-(6-methoxynaphthalen-2-yl)propan-2-yl] benzenesulfonate |
|---|---|
| PubChem CID | 88741781 |
| Molecular Formula | C20H20O5S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | [(2S)-1-hydroxy-3-(6-methoxynaphthalen-2-yl)propan-2-yl] benzenesulfonate |
| SMILES | COc1ccc2cc(C[C@@H](CO)OS(=O)(=O)c3ccccc3)ccc2c1 |
| InChI | InChI=1S/C20H20O5S/c1-24-18-10-9-16-11-15(7-8-17(16)13-18)12-19(14-21)25-26(22,23)20-5-3-2-4-6-20/h2-11,13,19,21H,12,14H2,1H3/t19-/m0/s1 |
| InChIKey | NFVSRASXQYTZQF-IBGZPJMESA-N |
| XLogP | 3.16 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|