C4H9BrO4 — CID 88743999
bromo acetate;ethane-1,2-diol (PubChem CID 88743999) has the molecular formula C4H9BrO4 and a molecular weight of 201.02 g/mol. Its IUPAC name is bromo acetate;ethane-1,2-diol.
| Compound Name | bromo acetate;ethane-1,2-diol |
|---|---|
| PubChem CID | 88743999 |
| Molecular Formula | C4H9BrO4 |
| Molecular Weight | 201.02 g/mol |
| Exact Mass | 199.97 |
| IUPAC Name | bromo acetate;ethane-1,2-diol |
| SMILES | CC(=O)OBr.OCCO |
| InChI | InChI=1S/C2H3BrO2.C2H6O2/c1-2(4)5-3;3-1-2-4/h1H3;3-4H,1-2H2 |
| InChIKey | OPNNSFUKCRTZNB-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.02 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |