About 4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane
4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane (PubChem CID 88745272) has the molecular formula C18H38O
and a molecular weight of 270.50 g/mol. Its IUPAC name is 4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane.
Molecular Properties
| Compound Name | 4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane |
| PubChem CID | 88745272 |
| Molecular Formula | C18H38O |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.29 |
| IUPAC Name | 4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane |
| SMILES | CCC(C)(COCC(C)(CC)CC(C)C)CC(C)C |
| InChI | InChI=1S/C18H38O/c1-9-17(7,11-15(3)4)13-19-14-18(8,10-2)12-16(5)6/h15-16H,9-14H2,1-8H3 |
| InChIKey | MEWRWOHKDKTNRU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane?
The IUPAC name of 4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane (CID 88745272) is 4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane.
What is the SMILES notation for 4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane?
The canonical SMILES for 4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane is CCC(C)(COCC(C)(CC)CC(C)C)CC(C)C.
What is the InChIKey of 4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane?
The InChIKey is MEWRWOHKDKTNRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O/c1-9-17(7,11-15(3)4)13-19-14-18(8,10-2)12-16(5)6/h15-16H,9-14H2,1-8H3.
What are the key properties of 4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane?
4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane has a molecular weight of 270.50 g/mol, XLogP of 5.93, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-ethyl-2,4-dimethylpentoxy)methyl]-2,4-dimethylhexane is sourced from PubChem (CID 88745272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).