About carbonic acid;sulfane;sulfurous acid
carbonic acid;sulfane;sulfurous acid (PubChem CID 88746188) has the molecular formula CH6O6S2
and a molecular weight of 178.19 g/mol. Its IUPAC name is carbonic acid;sulfane;sulfurous acid.
Molecular Properties
| Compound Name | carbonic acid;sulfane;sulfurous acid |
| PubChem CID | 88746188 |
| Molecular Formula | CH6O6S2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 177.96 |
| IUPAC Name | carbonic acid;sulfane;sulfurous acid |
| SMILES | O=C(O)O.O=S(O)O.S |
| InChI | InChI=1S/CH2O3.H2O3S.H2S/c2-1(3)4;1-4(2)3;/h(H2,2,3,4);(H2,1,2,3);1H2 |
| InChIKey | RTQVXZUUHLEBCT-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;sulfane;sulfurous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;sulfane;sulfurous acid?
The IUPAC name of carbonic acid;sulfane;sulfurous acid (CID 88746188) is carbonic acid;sulfane;sulfurous acid.
What is the SMILES notation for carbonic acid;sulfane;sulfurous acid?
The canonical SMILES for carbonic acid;sulfane;sulfurous acid is O=C(O)O.O=S(O)O.S.
What is the InChIKey of carbonic acid;sulfane;sulfurous acid?
The InChIKey is RTQVXZUUHLEBCT-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.H2O3S.H2S/c2-1(3)4;1-4(2)3;/h(H2,2,3,4);(H2,1,2,3);1H2.
What are the key properties of carbonic acid;sulfane;sulfurous acid?
carbonic acid;sulfane;sulfurous acid has a molecular weight of 178.19 g/mol, XLogP of 0.02, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;sulfane;sulfurous acid is sourced from PubChem (CID 88746188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).