C31H46O4 — CID 88749223
[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)-2,2-dimethylpropyl] 4-octoxybenzoate (PubChem CID 88749223) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is [3-(3-tert-butyl-4-hydroxy-5-methylphenyl)-2,2-dimethylpropyl] 4-octoxybenzoate.
| Compound Name | [3-(3-tert-butyl-4-hydroxy-5-methylphenyl)-2,2-dimethylpropyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 88749223 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | [3-(3-tert-butyl-4-hydroxy-5-methylphenyl)-2,2-dimethylpropyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)OCC(C)(C)Cc2cc(C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C31H46O4/c1-8-9-10-11-12-13-18-34-26-16-14-25(15-17-26)29(33)35-22-31(6,7)21-24-19-23(2)28(32)27(20-24)30(3,4)5/h14-17,19-20,32H,8-13,18,21-22H2,1-7H3 |
| InChIKey | BBRZWTSUNWYWAJ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|