C12H16F3O5P — CID 88750216
butan-2-yloxy-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]phosphinic acid (PubChem CID 88750216) has the molecular formula C12H16F3O5P and a molecular weight of 328.22 g/mol. Its IUPAC name is butan-2-yloxy-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]phosphinic acid |
|---|---|
| PubChem CID | 88750216 |
| Molecular Formula | C12H16F3O5P |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | butan-2-yloxy-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C(O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F3O5P/c1-3-8(2)20-21(17,18)11(16)9-4-6-10(7-5-9)19-12(13,14)15/h4-8,11,16H,3H2,1-2H3,(H,17,18) |
| InChIKey | GRBWFCUNJUVILB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|