C12H18O7 — CID 88750735
4-(3-carboxy-2-methylbutanoyl)oxy-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 88750735) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is 4-(3-carboxy-2-methylbutanoyl)oxy-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(3-carboxy-2-methylbutanoyl)oxy-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88750735 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-(3-carboxy-2-methylbutanoyl)oxy-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C(=O)O)C(C)C(=O)OC(=O)C(C)C(C)C(=O)O |
| InChI | InChI=1S/C12H18O7/c1-5(9(13)14)7(3)11(17)19-12(18)8(4)6(2)10(15)16/h5-8H,1-4H3,(H,13,14)(H,15,16) |
| InChIKey | CRGKNWBLYKBKCR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|