C6H12N2O4 — CID 22892701
diamino 2,3-dimethylbutanedioate (PubChem CID 22892701) has the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. Its IUPAC name is diamino 2,3-dimethylbutanedioate.
| Compound Name | diamino 2,3-dimethylbutanedioate |
|---|---|
| PubChem CID | 22892701 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | diamino 2,3-dimethylbutanedioate |
| SMILES | CC(C(=O)ON)C(C)C(=O)ON |
| InChI | InChI=1S/C6H12N2O4/c1-3(5(9)11-7)4(2)6(10)12-8/h3-4H,7-8H2,1-2H3 |
| InChIKey | IVNUZYNSQSPGPZ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|