About calcium;amino 2-hydroxypropanoate;hydride
calcium;amino 2-hydroxypropanoate;hydride (PubChem CID 173433057) has the molecular formula C3H9CaNO3
and a molecular weight of 147.19 g/mol. Its IUPAC name is calcium;amino 2-hydroxypropanoate;hydride.
Molecular Properties
| Compound Name | calcium;amino 2-hydroxypropanoate;hydride |
| PubChem CID | 173433057 |
| Molecular Formula | C3H9CaNO3 |
| Molecular Weight | 147.19 g/mol |
| Exact Mass | 147.02 |
| IUPAC Name | calcium;amino 2-hydroxypropanoate;hydride |
| SMILES | CC(O)C(=O)ON.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C3H7NO3.Ca.2H/c1-2(5)3(6)7-4;;;/h2,5H,4H2,1H3;;;/q;+2;2*-1 |
| InChIKey | JPYJTUIXSYLQSS-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.19 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze calcium;amino 2-hydroxypropanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;amino 2-hydroxypropanoate;hydride?
The IUPAC name of calcium;amino 2-hydroxypropanoate;hydride (CID 173433057) is calcium;amino 2-hydroxypropanoate;hydride.
What is the SMILES notation for calcium;amino 2-hydroxypropanoate;hydride?
The canonical SMILES for calcium;amino 2-hydroxypropanoate;hydride is CC(O)C(=O)ON.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;amino 2-hydroxypropanoate;hydride?
The InChIKey is JPYJTUIXSYLQSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO3.Ca.2H/c1-2(5)3(6)7-4;;;/h2,5H,4H2,1H3;;;/q;+2;2*-1.
What are the key properties of calcium;amino 2-hydroxypropanoate;hydride?
calcium;amino 2-hydroxypropanoate;hydride has a molecular weight of 147.19 g/mol, XLogP of -1.37, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;amino 2-hydroxypropanoate;hydride is sourced from PubChem (CID 173433057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).