About calcium;hydride;phosphanyl 2-hydroxypropanoate
calcium;hydride;phosphanyl 2-hydroxypropanoate (PubChem CID 174498775) has the molecular formula C3H9CaO3P
and a molecular weight of 164.15 g/mol. Its IUPAC name is calcium;hydride;phosphanyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | calcium;hydride;phosphanyl 2-hydroxypropanoate |
| PubChem CID | 174498775 |
| Molecular Formula | C3H9CaO3P |
| Molecular Weight | 164.15 g/mol |
| Exact Mass | 163.99 |
| IUPAC Name | calcium;hydride;phosphanyl 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OP.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C3H7O3P.Ca.2H/c1-2(4)3(5)6-7;;;/h2,4H,7H2,1H3;;;/q;+2;2*-1 |
| InChIKey | DSOSCKIRDVKTJD-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.15 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydride;phosphanyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;phosphanyl 2-hydroxypropanoate?
The IUPAC name of calcium;hydride;phosphanyl 2-hydroxypropanoate (CID 174498775) is calcium;hydride;phosphanyl 2-hydroxypropanoate.
What is the SMILES notation for calcium;hydride;phosphanyl 2-hydroxypropanoate?
The canonical SMILES for calcium;hydride;phosphanyl 2-hydroxypropanoate is CC(O)C(=O)OP.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;phosphanyl 2-hydroxypropanoate?
The InChIKey is DSOSCKIRDVKTJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O3P.Ca.2H/c1-2(4)3(5)6-7;;;/h2,4H,7H2,1H3;;;/q;+2;2*-1.
What are the key properties of calcium;hydride;phosphanyl 2-hydroxypropanoate?
calcium;hydride;phosphanyl 2-hydroxypropanoate has a molecular weight of 164.15 g/mol, XLogP of -0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;phosphanyl 2-hydroxypropanoate is sourced from PubChem (CID 174498775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).